4-Aminophenol sulfate 99% cas 63084-98-0
4-Aminophenol sulfate
English name: p-Aminophenol sulfate
Alias: Phenol, 4-amino-, hydrogen sulfate (ester); 4-Aminophenol sulfate; Sulfuric acid, 4-aminophenyl ester; 4-hydroxyanilinium hydrogen sulfate
CAS NO: 63084-98-0
Molecular weight: 205.1896
Molecular formula: C6H7NO5S InChI: InChI=1/C6H7NO.H2O4S/c7-5-1-3-6(8)4-2-5;1-5(2,3)4/h1-4,8H,7H2;(H2,1,2,3,4)/p-2
Molecular weight: 205.1896
Molecular formula: C6H7NO5S
Packing: 25kg fiber drum
Uses: Used in organic synthesis
|
ITEM
|
INDEX
|
|
Appearance
|
Off-white powdery crystal
|
|
Purity(GC)% ≥
|
99.0
|
|
* In addition：The company could research and develop the new products according to the special demand of our clients．
|
|
Write your message here and send it to us
