99.8% Isophthaloyl dichloride cas 99-63-8
Isophthaloyl dichloride
English name: Isophthaloyl dichloride
CAS NO: 99-63-8
Molecular weight: 203.0222
EC NO: 202-774-7
Molecular formula: C8H4Cl2O2
InChI: InChI=1/C8H4Cl2O2/c9-7(11)5-2-1-3-6(4-5)8(10)12/h1-4H
Molecular formula: C8H4Cl2O2
Molecular weight: 203.02
Packing: 250kg plastic drum
1. Can be used as intermediate for pesticide, medicine and high polymer
2. Can be used in polyacrylate, high-temperature resistant resin, dye, pigment, medicine, pesticide, etc.
3. As raw material for fiber
|
ITEM
|
INDEX
|
|
Appearance
|
White crystal
|
|
Purity(GC)% ≥
|
99.8
|
|
* In addition：The company could research and develop the new products according to the special demand of our clients．
|
|
Write your message here and send it to us
